CAS 735275-64-6

cis-4-[2-(2-Fluorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-(2-Fluorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclohexane ring and a carboxylic acid functional group. The presence of a fluorophenyl moiety contributes to its potential biological activity and lipophilicity. The "cis" configuration indicates that specific substituents on the cyclohexane ring are oriented on the same side, influencing the compound's three-dimensional shape and reactivity. This compound may exhibit interesting pharmacological properties due to its structural characteristics, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the fluorine atom, which can affect electron density and hydrogen bonding capabilities. Additionally, the carboxylic acid group can participate in various chemical reactions, including esterification and acid-base reactions. Overall, the compound's unique structure and functional groups suggest potential applications in drug development and other chemical research areas.

Formula: C₁₅H₁₇FO₃

InChI: InChI=1/C15H17FO3/c16-13-4-2-1-3-12(13)14(17)9-10-5-7-11(8-6-10)15(18)19/h1-4,10-11H,5-9H2,(H,18,19)/t10-,11+

InChI key: InChIKey=PHHIFFQPCUJPBM-PHIMTYICNA-N

SMILES: C(C(=O)C1=C(F)C=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2

Synonyms:

• cis-4-[2-(2-Fluorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-(2-fluorophenyl)-2-oxoethyl]-, cis-