CAS 735275-65-7

cis-4-[2-(2-Iodophenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-(2-Iodophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclohexane ring and a carboxylic acid functional group. The presence of the 2-iodophenyl moiety contributes to its potential reactivity and biological activity. This compound is likely to exhibit specific stereochemical properties due to the "cis" configuration, which can influence its interactions with biological targets. The carboxylic acid group suggests that it may participate in acid-base reactions and form salts or esters. Additionally, the presence of the iodine atom may enhance the compound's lipophilicity and influence its pharmacokinetic properties. Overall, the characteristics of this compound make it of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific biological activities or therapeutic applications. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₅H₁₇IO₃

InChI: InChI=1/C15H17IO3/c16-13-4-2-1-3-12(13)14(17)9-10-5-7-11(8-6-10)15(18)19/h1-4,10-11H,5-9H2,(H,18,19)/t10-,11+

InChI key: InChIKey=RRPWJEVRSVJDIK-PHIMTYICNA-N

SMILES: C(C(=O)C1=C(I)C=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2

Synonyms:

• cis-4-[2-(2-Iodophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-(2-iodophenyl)-2-oxoethyl]-, cis-