CAS 735275-69-1

cis-4-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a cyclohexane ring, a carboxylic acid functional group, and a trifluoromethyl-substituted phenyl group. The presence of the cis configuration indicates specific stereochemistry, which can influence the compound's reactivity and interactions. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and potentially affecting biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of the ketone functional group contributes to its reactivity, allowing for various chemical transformations. Overall, this compound's unique characteristics stem from its functional groups and stereochemistry, which can significantly influence its behavior in chemical and biological systems.

Formula: C₁₆H₁₇F₃O₃

InChI: InChI=1/C16H17F3O3/c17-16(18,19)13-3-1-2-12(9-13)14(20)8-10-4-6-11(7-5-10)15(21)22/h1-3,9-11H,4-8H2,(H,21,22)/t10-,11+

InChI key: InChIKey=YFQPCWHDWXMIFZ-PHIMTYICNA-N

SMILES: C(C[C@H]1CC[C@@H](C(O)=O)CC1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• cis-4-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-, cis-