CAS 735275-78-2

trans-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Trans-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its cyclohexane backbone, which is substituted with a carboxylic acid group and a ketone moiety linked to a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic interactions due to the methoxyphenyl group. The presence of the carboxylic acid functional group suggests that it can participate in hydrogen bonding and may exhibit acidic behavior in solution. The trans configuration indicates a specific stereochemistry that can influence the compound's reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly for its potential biological activities, which could include anti-inflammatory or analgesic effects. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a candidate for further study in drug development or chemical synthesis.

Formula: C₁₆H₂₀O₄

InChI: InChI=1/C16H20O4/c1-20-15-5-3-2-4-13(15)14(17)10-11-6-8-12(9-7-11)16(18)19/h2-5,11-12H,6-10H2,1H3,(H,18,19)/t11-,12-

InChI key: InChIKey=YALZQBZQWJJHEI-HAQNSBGRNA-N

SMILES: C(C[C@H]1CC[C@H](C(O)=O)CC1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• trans-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-(2-methoxyphenyl)-2-oxoethyl]-, trans-