CAS 735275-79-3

trans-4-[2-(3-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Trans-4-[2-(3-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its cyclohexane backbone, which is substituted with a carboxylic acid group and a ketone moiety linked to a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic structures, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The trans configuration of the cyclohexane ring suggests a specific spatial arrangement that can affect the compound's reactivity and binding affinity to biological targets. Additionally, the carboxylic acid functional group may participate in hydrogen bonding, influencing its pharmacokinetic properties. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₁₆H₂₀O₄

InChI: InChI=1/C16H20O4/c1-20-14-4-2-3-13(10-14)15(17)9-11-5-7-12(8-6-11)16(18)19/h2-4,10-12H,5-9H2,1H3,(H,18,19)/t11-,12-

InChI key: InChIKey=IQGQDTACCSISDM-HAQNSBGRNA-N

SMILES: C(C[C@H]1CC[C@H](C(O)=O)CC1)(=O)C2=CC(OC)=CC=C2

Synonyms:

• trans-4-[2-(3-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-(3-methoxyphenyl)-2-oxoethyl]-, trans-