CAS 735305-60-9

4-Methoxy-3-[(2-methyl-1-piperidinyl)sulfonyl]benzoic acid

Description:

4-Methoxy-3-[(2-methyl-1-piperidinyl)sulfonyl]benzoic acid, with the CAS number 735305-60-9, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety substituted with a methoxy group and a sulfonyl group linked to a piperidine ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its piperidine component, which is often associated with pharmacological effects. The presence of the sulfonyl group may enhance its reactivity and interaction with biological targets. Additionally, the methoxy group can influence the compound's lipophilicity and overall stability. As a benzoic acid derivative, it may participate in various chemical reactions, including esterification and amidation. Its specific applications and biological activities would depend on further research, particularly in medicinal chemistry, where such compounds are often explored for therapeutic potential. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₁₉NO₅S

InChI: InChI=1S/C14H19NO5S/c1-10-5-3-4-8-15(10)21(18,19)13-9-11(14(16)17)6-7-12(13)20-2/h6-7,9-10H,3-5,8H2,1-2H3,(H,16,17)

InChI key: InChIKey=ZFKAVMZVNPQZBV-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(OC)C=CC(C(O)=O)=C1)N2C(C)CCCC2

Synonyms:

• 4-Methoxy-3-[(2-methyl-1-piperidinyl)sulfonyl]benzoic acid
• Benzoic acid, 4-methoxy-3-[(2-methyl-1-piperidinyl)sulfonyl]-

4-Methoxy-3-[(2-methylpiperidin-1-yl)sulfonyl]benzoic acid

CAS: 735305-60-9

Versatile small molecule scaffold

Formula: C₁₄H₁₉NO₅S

Purity: Min. 95%

Molecular weight: 313.37 g/mol

Ref: 3D-KEB30560