
CAS 735322-58-4
:2,4-Dihydro-4-[4-(1-methylpropyl)phenyl]-1-thioxo[1,2,4]triazolo[4,3-a]quinazolin-5(1H)-one
Description:
2,4-Dihydro-4-[4-(1-methylpropyl)phenyl]-1-thioxo[1,2,4]triazolo[4,3-a]quinazolin-5(1H)-one is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a quinazolinone core fused with a triazole ring. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of a 1-methylpropyl group attached to a phenyl ring enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its unique arrangement of functional groups may also confer specific interactions with biological targets, making it a subject of interest for further research. As with many synthetic compounds, understanding its stability, solubility, and reactivity under different conditions is crucial for evaluating its practical applications. Safety and toxicity assessments are also essential for any potential therapeutic use.
Formula:C19H18N4OS
InChI:InChI=1S/C19H18N4OS/c1-3-12(2)13-8-10-14(11-9-13)22-17(24)15-6-4-5-7-16(15)23-18(22)20-21-19(23)25/h4-12H,3H2,1-2H3,(H,21,25)
InChI key:InChIKey=VYKRXNSTDHIOKN-UHFFFAOYSA-N
SMILES:O=C1N(C=2N(C=3C1=CC=CC3)C(=S)NN2)C4=CC=C(C(CC)C)C=C4
Synonyms:- [1,2,4]Triazolo[4,3-a]quinazolin-5(1H)-one, 2,4-dihydro-4-[4-(1-methylpropyl)phenyl]-1-thioxo-
- 2,4-Dihydro-4-[4-(1-methylpropyl)phenyl]-1-thioxo[1,2,4]triazolo[4,3-a]quinazolin-5(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.