CAS 735322-66-4

4-(1-Pyrrolidinylsulfonyl)benzoic acid hydrazide

Description:

4-(1-Pyrrolidinylsulfonyl)benzoic acid hydrazide, identified by its CAS number 735322-66-4, is a chemical compound characterized by its hydrazide functional group attached to a benzoic acid moiety. This compound features a pyrrolidinylsulfonyl substituent, which contributes to its unique chemical properties. Typically, compounds of this nature exhibit moderate to high solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions. The sulfonyl group enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including coupling reactions and as a building block in drug synthesis. Additionally, the presence of the hydrazide functional group may impart biological activity, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. As with any chemical substance, safety data and handling precautions should be reviewed before use, considering its potential reactivity and biological effects.

Formula: C₁₁H₁₅N₃O₃S

InChI: InChI=1S/C11H15N3O3S/c12-13-11(15)9-3-5-10(6-4-9)18(16,17)14-7-1-2-8-14/h3-6H,1-2,7-8,12H2,(H,13,15)

InChI key: InChIKey=OJOMJVZSAFQXRT-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(C(NN)=O)C=C1)N2CCCC2

Synonyms:

• Benzoic acid, 4-(1-pyrrolidinylsulfonyl)-, hydrazide
• 4-(1-Pyrrolidinylsulfonyl)benzoic acid hydrazide