CAS 735322-67-5

3-Amino-N,N-diethyl-4-(ethylamino)benzenesulfonamide

Description:

3-Amino-N,N-diethyl-4-(ethylamino)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features an aromatic benzene ring substituted with an amino group and two ethylamino groups, contributing to its potential biological activity. The presence of the sulfonamide moiety suggests that it may interact with biological systems, possibly inhibiting certain enzymes or pathways. The diethyl and ethylamino substituents enhance its solubility and may influence its pharmacokinetic properties. This compound is likely to be a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. However, specific safety and handling information, as well as detailed biological activity, would require further investigation and should be referenced from appropriate safety data sheets and scientific literature.

Formula: C₁₂H₂₁N₃O₂S

InChI: InChI=1S/C12H21N3O2S/c1-4-14-12-8-7-10(9-11(12)13)18(16,17)15(5-2)6-3/h7-9,14H,4-6,13H2,1-3H3

InChI key: InChIKey=IDDMVWHKXNLQMC-UHFFFAOYSA-N

SMILES: S(N(CC)CC)(=O)(=O)C1=CC(N)=C(NCC)C=C1

Synonyms:

• 3-Amino-N,N-diethyl-4-(ethylamino)benzenesulfonamide
• Benzenesulfonamide, 3-amino-N,N-diethyl-4-(ethylamino)-