CAS 735322-72-2

Methyl 4-[2-amino-4-(1-piperidinylsulfonyl)phenoxy]benzoate

Description:

Methyl 4-[2-amino-4-(1-piperidinylsulfonyl)phenoxy]benzoate, with the CAS number 735322-72-2, is a chemical compound characterized by its complex structure, which includes a methyl ester group, an amino group, and a piperidine sulfonyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be soluble in organic solvents due to its hydrophobic aromatic components, while the presence of polar functional groups may impart some degree of hydrophilicity. The compound may also exhibit basic properties due to the amino group, which can participate in hydrogen bonding and influence its reactivity. Methyl 4-[2-amino-4-(1-piperidinylsulfonyl)phenoxy]benzoate is of interest in medicinal chemistry, potentially serving as a lead compound for the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography.

Formula: C₁₉H₂₂N₂O₅S

InChI: InChI=1S/C19H22N2O5S/c1-25-19(22)14-5-7-15(8-6-14)26-18-10-9-16(13-17(18)20)27(23,24)21-11-3-2-4-12-21/h5-10,13H,2-4,11-12,20H2,1H3

InChI key: InChIKey=KHOIAHNAKYMANE-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(N)=C(OC2=CC=C(C(OC)=O)C=C2)C=C1)N3CCCCC3

Synonyms:

• Benzoic acid, 4-[2-amino-4-(1-piperidinylsulfonyl)phenoxy]-, methyl ester
• Methyl 4-[2-amino-4-(1-piperidinylsulfonyl)phenoxy]benzoate

Methyl 4-[2-amino-4-(piperidine-1-sulfonyl)phenoxy]benzoate

CAS: 735322-72-2

Versatile small molecule scaffold

Formula: C₁₉H₂₂N₂O₅S

Purity: Min. 95%

Molecular weight: 390.5 g/mol

Ref: 3D-KEB32272