CAS 735322-77-7

2-(3-Bromophenoxy)-5-(4-morpholinylsulfonyl)benzenamine

Description:

2-(3-Bromophenoxy)-5-(4-morpholinylsulfonyl)benzenamine, with the CAS number 735322-77-7, is a chemical compound characterized by its complex structure, which includes a bromophenyl group, a morpholine moiety, and a sulfonyl functional group. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the bromine atom may impart specific reactivity, making it useful in various synthetic applications. The morpholine ring contributes to its potential biological activity, as morpholines are often found in pharmaceuticals and agrochemicals. Additionally, the sulfonyl group can enhance the compound's solubility and reactivity, influencing its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential applications in drug development or as a chemical intermediate. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₆H₁₇BrN₂O₄S

InChI: InChI=1S/C16H17BrN2O4S/c17-12-2-1-3-13(10-12)23-16-5-4-14(11-15(16)18)24(20,21)19-6-8-22-9-7-19/h1-5,10-11H,6-9,18H2

InChI key: InChIKey=WCXJDCNXZFWZPB-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(N)=C(OC2=CC(Br)=CC=C2)C=C1)N3CCOCC3

Synonyms:

• Morpholine, 4-[[3-amino-4-(3-bromophenoxy)phenyl]sulfonyl]-
• 2-(3-Bromophenoxy)-5-(4-morpholinylsulfonyl)benzenamine
• Benzenamine, 2-(3-bromophenoxy)-5-(4-morpholinylsulfonyl)-