CAS 73536-57-9

12-oxooctadecanoyloxysodium

Description:

12-Oxooctadecanoyloxysodium, identified by its CAS number 73536-57-9, is a chemical compound that belongs to the class of fatty acid derivatives. It features a long hydrocarbon chain, characteristic of fatty acids, which contributes to its amphiphilic nature, allowing it to interact with both hydrophilic and hydrophobic environments. The presence of the oxo group (a carbonyl group) at the 12th carbon position indicates that it may exhibit specific reactivity and properties associated with ketones. This compound is likely to have applications in various fields, including biochemistry and materials science, particularly in the formulation of surfactants or emulsifiers due to its ability to stabilize mixtures of oil and water. Additionally, its sodium salt form suggests solubility in aqueous solutions, which can enhance its utility in biological systems or as a reagent in chemical reactions. Overall, 12-oxooctadecanoyloxysodium exemplifies the diverse functionalities that can arise from modifications to fatty acid structures.

Formula: C₁₈H₃₃NaO₃

InChI: InChI=1/C18H34O3.Na/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h2-16H2,1H3,(H,20,21);/q;+1/p-1

SMILES: CCCCCCC(=O)CCCCCCCCCCC(=O)O.[Na]

12-Ketostearic Acid Sodium Salt

Controlled Product

CAS: 73536-57-9

Formula: C₁₈H₃₃NaO₃

Color and Shape: Neat

Molecular weight: 320.44

Ref: TR-K264901