CAS 73536-82-0

5-Chloro-2,3-dihydro-N-methyl-1H-inden-2-amine

Description:

5-Chloro-2,3-dihydro-N-methyl-1H-inden-2-amine, with the CAS number 73536-82-0, is a chemical compound characterized by its unique bicyclic structure, which includes an indene framework. This compound features a chlorine atom at the 5-position and a methylamino group at the 2-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its electronic properties and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the N-methyl group can affect the compound's pharmacokinetics and interaction with biological targets. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity. Further studies may be necessary to fully elucidate its properties and applications in various fields.

Formula: C₁₀H₁₂ClN

InChI: InChI=1S/C10H12ClN/c1-12-10-5-7-2-3-9(11)4-8(7)6-10/h2-4,10,12H,5-6H2,1H3

InChI key: InChIKey=HBJGBMRDHFYFIG-UHFFFAOYSA-N

SMILES: N(C)C1CC=2C(C1)=CC(Cl)=CC2

Synonyms:

• 5-Chloro-N-methyl-2-indanamine
• 5-Chloro-2,3-dihydro-N-methyl-1H-inden-2-amine
• 1H-Inden-2-amine, 5-chloro-2,3-dihydro-N-methyl-