CAS 73536-87-5

5-nitro-2,3-dihydro-1H-inden-2-amine hydrochloride (1:1)

Description:

5-Nitro-2,3-dihydro-1H-inden-2-amine hydrochloride is a chemical compound characterized by its unique structure, which includes a nitro group and an amine functional group. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which makes it useful in various chemical applications. The presence of the nitro group contributes to its reactivity, allowing it to participate in electrophilic substitution reactions. The amine group can act as a nucleophile, making it suitable for further derivatization. This compound is often studied in the context of medicinal chemistry due to its potential biological activity, particularly in relation to its structural analogs. Its hydrochloride salt form enhances its stability and solubility, facilitating its use in laboratory settings. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards. Proper storage and handling protocols are essential to mitigate risks associated with exposure.

Formula: C₉H₁₁ClN₂O₂

InChI: InChI=1/C9H10N2O2.ClH/c10-8-3-6-1-2-9(11(12)13)5-7(6)4-8;/h1-2,5,8H,3-4,10H2;1H

SMILES: c1cc(cc2CC(Cc12)N)N(=O)=O.Cl

2-Amino-5-nitroindan hydrochloride

Controlled Product

CAS: 73536-87-5

Please enquire for more information about 2-Amino-5-nitroindan hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₁₀N₂O₂·HCl

Purity: Min. 95%

Molecular weight: 214.65 g/mol

Ref: 3D-FA52091