CAS 73538-32-6
:O1,O1-ditert-butyl O3-ethyl 3-aminopropane-1,1,3-tricarboxylate
Description:
O1,O1-Ditert-butyl O3-ethyl 3-aminopropane-1,1,3-tricarboxylate, with the CAS number 73538-32-6, is a chemical compound characterized by its complex structure that includes multiple functional groups. It features tert-butyl groups, which are bulky and provide steric hindrance, influencing its reactivity and solubility. The presence of ethyl and amino groups suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in medicinal chemistry and organic synthesis. The tricarboxylate moiety indicates that it can act as a versatile building block in various chemical reactions, particularly in the formation of esters and amides. This compound may exhibit properties such as moderate to high polarity due to the carboxylate groups, affecting its solubility in polar solvents. Additionally, its structural complexity may confer unique physical and chemical properties, such as stability under certain conditions and potential applications in drug development or as a reagent in organic synthesis. Overall, its characteristics make it a subject of interest in both academic and industrial chemistry contexts.
Formula:C16H29NO6
InChI:InChI=1/C16H29NO6/c1-8-21-14(20)11(17)9-10(12(18)22-15(2,3)4)13(19)23-16(5,6)7/h10-11H,8-9,17H2,1-7H3
SMILES:CCOC(=O)C(CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
γ-Carboxyglutamic Acid γ,γ-Di-t-butyl 3-Ethyl Ester
CAS:Controlled ProductFormula:C16H29NO6Color and Shape:NeatMolecular weight:331.405

