CAS 73540-76-8

N,N-Diethyl-3-furancarboxamide

Description:

N,N-Diethyl-3-furancarboxamide, with the CAS number 73540-76-8, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features two ethyl groups attached to the nitrogen atom of the amide functional group, contributing to its solubility and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the furan ring imparts unique chemical properties, including potential reactivity in electrophilic substitution reactions. N,N-Diethyl-3-furancarboxamide is often studied for its applications in pharmaceuticals, agrochemicals, and as a solvent or intermediate in organic synthesis. Its safety profile should be considered, as with all chemical substances, and appropriate handling procedures should be followed to mitigate any potential hazards. Overall, this compound exemplifies the diverse chemistry associated with furan derivatives and their utility in various chemical applications.

Formula: C₉H₁₃NO₂

InChI: InChI=1S/C9H13NO2/c1-3-10(4-2)9(11)8-5-6-12-7-8/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=UHSKIRZPFSOLEW-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(=O)C=1C=COC1

Synonyms:

• AI 3-70620
• 3-Furancarboxamide, N,N-diethyl-
• N,N-Diethylfuran-3-carboxamide
• N,N-Diethyl-3-furancarboxamide