CAS 73548-13-7

3-[(2-Phenylacetyl)amino]benzoic acid

Description:

3-[(2-Phenylacetyl)amino]benzoic acid, with the CAS number 73548-13-7, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the 2-phenylacetyl group introduces a ketone functionality, enhancing its reactivity and solubility in organic solvents. This compound is likely to exhibit moderate to high lipophilicity due to the phenyl groups, which can influence its biological activity and interactions with other molecules. Additionally, the amine linkage suggests potential for forming amide bonds, making it relevant in medicinal chemistry and drug design. Its structural characteristics may allow for various applications, including as an intermediate in organic synthesis or as a potential pharmaceutical agent. Overall, 3-[(2-Phenylacetyl)amino]benzoic acid is a compound of interest due to its unique structural features and potential utility in various chemical and biological contexts.

Formula: C₁₅H₁₃NO₃

InChI: InChI=1S/C15H13NO3/c17-14(9-11-5-2-1-3-6-11)16-13-8-4-7-12(10-13)15(18)19/h1-8,10H,9H2,(H,16,17)(H,18,19)

InChI key: InChIKey=JGBFNIWZGCHZMG-UHFFFAOYSA-N

SMILES: N(C(CC1=CC=CC=C1)=O)C2=CC(C(O)=O)=CC=C2

Synonyms:

• Benzoic acid, 3-[(phenylacetyl)amino]-
• 3-Phenylacetylamino-benzoic acid
• Benzoic acid, 3-[(2-phenylacetyl)amino]-
• 3-[(2-Phenylacetyl)amino]benzoic acid