CAS 7355-51-3

4-(2-Cyclohexen-1-yloxy)benzoic acid

Description:

4-(2-Cyclohexen-1-yloxy)benzoic acid, with the CAS number 7355-51-3, is an organic compound characterized by its aromatic structure and the presence of both a benzoic acid moiety and a cyclohexenyl ether group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The cyclohexenyl group contributes to its unique steric and electronic properties, which can influence its behavior in chemical reactions and interactions with biological systems. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, its structural features may impart specific biological activities, making it of interest in pharmaceutical and materials science research. Overall, 4-(2-Cyclohexen-1-yloxy)benzoic acid is a compound of interest due to its unique structural characteristics and potential applications.

Formula: C₁₃H₁₄O₃

InChI: InChI=1S/C13H14O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h2,4,6-9,11H,1,3,5H2,(H,14,15)

InChI key: InChIKey=PDVBRFKIRWATOO-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(O)=O)C=C1)C2CCCC=C2

Synonyms:

• 4-(Cyclohex-2-enyloxy)benzoic acid
• 4-(2-Cyclohexen-1-yloxy)benzoic acid
• Benzoic acid, p-(2-cyclohexen-1-yloxy)-
• NSC 59999
• Benzoic acid, 4-(2-cyclohexen-1-yloxy)-

4-(2-Cyclohexenyloxy)benzoic acid

CAS: 7355-51-3

4-(2-Cyclohexenyloxy)benzoic acid

Purity: 95%

Molecular weight: 218.25g/mol

Ref: 54-OR1004131