CAS 73553-80-7

4-Formyl-1-piperazinecarbothioamide

Description:

4-Formyl-1-piperazinecarbothioamide is a chemical compound characterized by its unique functional groups, including an aldehyde (formyl) and a thioamide. The presence of the piperazine ring contributes to its cyclic structure, which can influence its reactivity and biological activity. This compound typically exhibits properties associated with both amides and aldehydes, such as potential reactivity in condensation reactions and the ability to participate in nucleophilic attacks due to the electrophilic nature of the carbonyl group. Its thioamide functionality may enhance its stability and solubility in various solvents. Additionally, compounds like 4-Formyl-1-piperazinecarbothioamide are of interest in medicinal chemistry for their potential pharmacological properties, including antimicrobial and anticancer activities. The specific interactions and applications of this compound can vary based on its structural features and the presence of substituents, making it a subject of study in various fields, including organic synthesis and drug development. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₆H₁₁N₃OS

InChI: InChI=1S/C6H11N3OS/c7-6(11)9-3-1-8(5-10)2-4-9/h5H,1-4H2,(H2,7,11)

InChI key: InChIKey=VSOQJWQZXRMQFX-UHFFFAOYSA-N

SMILES: C(N)(=S)N1CCN(C=O)CC1

Synonyms:

• 1-Piperazinecarbothioamide, 4-formyl-
• 4-Formyl-1-piperazinecarbothioamide