CymitQuimica logo

CAS 7356-61-8

:

Ethyl 4-amino-2-methoxy-5-pyrimidinecarboxylate

Description:
Ethyl 4-amino-2-methoxy-5-pyrimidinecarboxylate, with the CAS number 7356-61-8, is a chemical compound that belongs to the class of pyrimidine derivatives. It features a pyrimidine ring substituted with an amino group, a methoxy group, and an ethyl ester functional group. This compound is typically characterized by its moderate solubility in polar solvents due to the presence of the amino and methoxy groups, which can engage in hydrogen bonding. Ethyl 4-amino-2-methoxy-5-pyrimidinecarboxylate is often studied for its potential biological activities, including its role as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The presence of the amino group suggests potential for reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. Overall, this compound is of interest in medicinal chemistry and may exhibit various pharmacological properties, although specific biological activities would require further investigation.
Formula:C8H11N3O3
InChI:InChI=1S/C8H11N3O3/c1-3-14-7(12)5-4-10-8(13-2)11-6(5)9/h4H,3H2,1-2H3,(H2,9,10,11)
InChI key:InChIKey=MBMGMEMKHNEBGI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(N)=NC(OC)=NC1
Synonyms:
  • Ethyl 4-amino-2-methoxy-5-pyrimidinecarboxylate
  • NSC 64954
  • 5-Pyrimidinecarboxylic acid, 4-amino-2-methoxy-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.