CymitQuimica logo

CAS 73561-90-7

:

Janthitrem B

Description:
Janthitrem B is a naturally occurring compound classified as a secondary metabolite, primarily produced by certain species of fungi, particularly those in the genus Penicillium. It is known for its complex structure, which includes multiple rings and functional groups that contribute to its biological activity. Janthitrem B exhibits antimicrobial properties, making it of interest in pharmaceutical research for potential therapeutic applications. The compound is also characterized by its unique chromophoric system, which can absorb light in specific wavelengths, leading to its distinctive coloration. Its solubility varies depending on the solvent, and it is typically more soluble in organic solvents than in water. The compound's stability can be influenced by environmental factors such as pH and temperature. Research into Janthitrem B continues to explore its biosynthetic pathways and potential uses in medicine, particularly in the development of new antimicrobial agents. Overall, Janthitrem B represents a fascinating subject of study within the field of natural products chemistry.
Formula:C37H47NO5
InChI:InChI=1S/C37H47NO5/c1-18(2)31-27(39)16-25-28(42-31)10-11-35(7)36(8)19(9-12-37(25,35)41)13-23-21-14-22-20(15-26(21)38-32(23)36)24-17-33(3,4)43-34(5,6)29(24)30(22)40/h14-17,19,27-31,38-41H,1,9-13H2,2-8H3/t19-,27+,28-,29+,30+,31+,35+,36+,37+/m0/s1
InChI key:InChIKey=FYYNBFCZCKFSKS-QSDHUPEDSA-N
SMILES:C[C@@]12[C@]3(C)[C@](O)(C=4[C@](CC3)(O[C@H](C(C)=C)[C@H](O)C4)[H])CC[C@]1(CC5=C2NC=6C5=CC7=C(C6)C=8[C@]([C@@H]7O)(C(C)(C)OC(C)(C)C8)[H])[H]
Synonyms:
  • Anhydrojanthitrem E
  • Janthitrem B
  • 4bH-Pyrano[2′′,3′′:5′,6′]benz[1′,2′:6,7]indeno[1,2-b]pyrano[4′,3′:3,4]cyclopent[1,2-f]indole-3,4b,9-triol, 2,3,5,6,6a,7,9,9a,10,12,15,15b,15c,16,17,17a-hexadecahydro-10,10,12,12,15b,15c-hexamethyl-2-(1-methylethenyl)-, (2R,3R,4bS,6aS,9S,9aR,15bS,15cR,17aS)-
  • 4bH-1-Benzopyrano[5′,6′:6,7]indeno[1,2-b]pyrano[4′,3′:3,4]cyclopent[1,2-f]indole-3,4b,9-triol, 2,3,5,6,6a,7,9,9a,10,12,15,15b,15c,16,17,17a-hexadecahydro-10,10,12,12,15b,15c-hexamethyl-2-(1-methylethenyl)-, (2R,3R,4bS,6aS,9S,9aR,15bS,15cR,17aS)-
  • (2R,3R,4bS,6aS,9S,9aR,15bS,15cR,17aS)-2,3,5,6,6a,7,9,9a,10,12,15,15b,15c,16,17,17a-Hexadecahydro-10,10,12,12,15b,15c-hexamethyl-2-(1-methylethenyl)-4bH-pyrano[2′′,3′′:5′,6′]benz[1′,2′:6,7]indeno[1,2-b]pyrano[4′,3′:3,4]cyclopent[1,2-f]indole-3,4b,9-triol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Janthitrem B

    CAS:
    Janthitrem B is a trematoxin produced by certain isolates of Penicillium violaceum.
    Formula:C37H47NO5
    Color and Shape:Solid
    Molecular weight:585.77

    Ref: TM-T32258

    25mg
    1,369.00€