CAS 73566-44-6

1-tert-butyl-4-(2-methylprop-2-enyl)benzene

Description:

1-tert-butyl-4-(2-methylprop-2-enyl)benzene, also known by its CAS number 73566-44-6, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a tert-butyl group and an allylic side chain. This compound typically exhibits hydrophobic properties due to its non-polar hydrocarbon structure, making it insoluble in water but soluble in organic solvents. The presence of the tert-butyl group contributes to its steric bulk, influencing its reactivity and interactions with other molecules. Additionally, the allylic group can participate in various chemical reactions, such as polymerization or electrophilic substitution. The compound may also exhibit interesting thermal and chemical stability, making it useful in various industrial applications, including as an intermediate in organic synthesis or as a potential additive in materials science. Overall, its unique structure imparts specific physical and chemical properties that can be leveraged in different chemical processes.

Formula: C₁₄H₂₀

InChI: InChI=1/C14H20/c1-11(2)10-12-6-8-13(9-7-12)14(3,4)5/h6-9H,1,10H2,2-5H3

SMILES: C=C(C)Cc1ccc(cc1)C(C)(C)C

Synonyms:

• 1-tert-Butyl-4-(2-methylprop-2-en-1-yl)benzene
• Benzene, 1-(1,1-Dimethylethyl)-4-(2-Methyl-2-Propen-1-Yl)-