CymitQuimica logo

CAS 73566-46-8

:

1-Fluoro-4-[(2-methyl-2-propen-1-yl)oxy]benzene

Description:
1-Fluoro-4-[(2-methyl-2-propen-1-yl)oxy]benzene, with the CAS number 73566-46-8, is an organic compound characterized by the presence of a fluorine atom and an allyl ether functional group attached to a benzene ring. This compound features a fluorine substituent at the para position relative to the ether linkage, which can influence its reactivity and physical properties. The presence of the allyl group contributes to its potential for undergoing various chemical reactions, such as polymerization or substitution reactions. The compound is likely to be a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its unique structure may impart specific characteristics such as increased lipophilicity and potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling, as fluorinated compounds can exhibit unique toxicological profiles. Overall, 1-Fluoro-4-[(2-methyl-2-propen-1-yl)oxy]benzene represents a versatile building block in synthetic organic chemistry.
Formula:C10H11FO
InChI:InChI=1S/C10H11FO/c1-8(2)7-12-10-5-3-9(11)4-6-10/h3-6H,1,7H2,2H3
InChI key:InChIKey=BGCMCUMAIKYHID-UHFFFAOYSA-N
SMILES:O(CC(C)=C)C1=CC=C(F)C=C1
Synonyms:
  • 1-Fluoro-4-((2-methylallyl)oxy)benzene
  • Benzene, 1-fluoro-4-[(2-methyl-2-propen-1-yl)oxy]-
  • 1-Fluoro-4-[(2-methyl-2-propen-1-yl)oxy]benzene
  • Benzene, 1-fluoro-4-[(2-methyl-2-propenyl)oxy]-
Found 3 products.