CymitQuimica logo

CAS 73568-42-0

:

8-Chloro-1,2-dihydro-2-oxo-3-quinolinecarboxaldehyde

Description:
8-Chloro-1,2-dihydro-2-oxo-3-quinolinecarboxaldehyde is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 8-position and an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonyl group (ketone) and the aldehyde enhances its electrophilic properties, making it useful in various chemical reactions, including condensation and substitution reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential biological activity, which has been explored in medicinal chemistry for the development of pharmaceuticals. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 8-Chloro-1,2-dihydro-2-oxo-3-quinolinecarboxaldehyde is of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H6ClNO2
InChI:InChI=1S/C10H6ClNO2/c11-8-3-1-2-6-4-7(5-13)10(14)12-9(6)8/h1-5H,(H,12,14)
InChI key:InChIKey=QKXNZUDICDPMPF-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=C(C=O)C(=O)N2)=CC=C1
Synonyms:
  • 3-Quinolinecarboxaldehyde, 8-chloro-1,2-dihydro-2-oxo-
  • 8-Chloro-1,2-dihydro-2-oxo-3-quinolinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.