CymitQuimica logo

CAS 7357-66-6

:

N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide

Description:
N-(5-bromo-4-methoxy-2-nitrophenyl)acetamide, with the CAS number 7357-66-6, is an organic compound characterized by its complex aromatic structure. It features a bromine atom, a methoxy group, and a nitro group attached to a phenyl ring, which contributes to its unique chemical properties. The presence of the acetamide functional group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and acylation reactions. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and organic synthesis, due to its potential biological activity. Its solubility may vary depending on the solvent, and it is important to handle it with care, as it may exhibit toxicity or environmental hazards. The compound's reactivity can be influenced by the electron-withdrawing nature of the nitro group and the electron-donating effect of the methoxy group, making it a subject of interest for further studies in chemical reactivity and pharmacological applications.
Formula:C9H9BrN2O4
InChI:InChI=1/C9H9BrN2O4/c1-5(13)11-7-3-6(10)9(16-2)4-8(7)12(14)15/h3-4H,1-2H3,(H,11,13)
SMILES:CC(=Nc1cc(c(cc1N(=O)=O)OC)Br)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.