CAS 7358-61-4
:1,3,5-Trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
1,3,5-Trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione, commonly known as Meldrum's acid derivative, is a heterocyclic organic compound characterized by its pyrimidine ring structure with three methyl groups attached at the 1, 3, and 5 positions and carbonyl groups at the 2, 4, and 6 positions. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. It exhibits a range of interesting chemical properties, including the ability to undergo various reactions typical of carbonyl compounds, such as nucleophilic addition and condensation reactions. The presence of the methyl groups contributes to its stability and influences its reactivity. Additionally, 1,3,5-Trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione is often utilized in organic synthesis and medicinal chemistry, serving as a building block for the synthesis of more complex molecules. Its unique structure and reactivity make it a valuable compound in various chemical applications.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-4-5(10)8(2)7(12)9(3)6(4)11/h4H,1-3H3
InChI key:InChIKey=OTSKHUNLOQPIGN-UHFFFAOYSA-N
SMILES:CC1C(=O)N(C)C(=O)N(C)C1=O
Synonyms:- NSC 120716
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,3,5-trimethyl-
- 1,3,5-trimethylpyrimidine-2,4,6(1H,3H,5H)-trione
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 1,3,5-trimethyl- (9CI)
- 1,3,5-Trimethylbarbituric acid
- 1,3,5-Trimethylbarbituric acid
- 5-24-09-00117 (Beilstein Handbook Reference)
- 1,3,5-Trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione
- 1,3,5-Trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione
- BRN 0149485
- Barbituric acid, 1,3,5-trimethyl-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.