
CAS 73583-40-1
:2-Bromo-α,α-diethyl-3-pyridinemethanol
Description:
2-Bromo-α,α-diethyl-3-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine substituent at the 2-position and two ethyl groups at the α-position relative to the hydroxymethyl group at the 3-position of the pyridine ring. The presence of the hydroxymethyl group contributes to its potential as a polar compound, influencing its solubility and reactivity. The bromine atom introduces a halogen functionality, which can participate in nucleophilic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, and it may be used in the synthesis of other chemical entities. As with many organic compounds, safety and handling precautions are essential due to the presence of bromine and the potential for toxicity. Proper storage and disposal methods should be followed in accordance with safety guidelines.
Formula:C10H14BrNO
InChI:InChI=1S/C10H14BrNO/c1-3-10(13,4-2)8-6-5-7-12-9(8)11/h5-7,13H,3-4H2,1-2H3
InChI key:InChIKey=UNANWWKRIAFVTJ-UHFFFAOYSA-N
SMILES:C(CC)(CC)(O)C1=C(Br)N=CC=C1
Synonyms:- 2-Bromo-α,α-diethyl-3-pyridinemethanol
- 3-Pyridinemethanol, 2-bromo-α,α-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.