CAS 73591-70-5

Methyl 5-propyl-3-pyridinecarboxylate

Description:

Methyl 5-propyl-3-pyridinecarboxylate, with the CAS number 73591-70-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate functional group, specifically an ester, where a methyl group is attached to the carboxylic acid moiety. The presence of a propyl group at the 5-position of the pyridine ring contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Methyl 5-propyl-3-pyridinecarboxylate is typically a colorless to pale yellow liquid with a distinctive odor. It is used in various applications, including as a building block in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. The compound's properties, such as boiling point, melting point, and specific reactivity, can vary based on environmental conditions and purity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-3-4-8-5-9(7-11-6-8)10(12)13-2/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=SXVRUNONBXCFJJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(CCC)C=NC1

Synonyms:

• Methyl 5-propyl-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 5-propyl-, methyl ester