CAS 73591-72-7

5-(1-Methylethyl)-3-pyridinecarboxamide

Description:

5-(1-Methylethyl)-3-pyridinecarboxamide, also known by its CAS number 73591-72-7, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxamide functional group, which contributes to its potential as a polar molecule, influencing its solubility and reactivity. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, potentially affecting its interactions in biological systems. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in hydrogen bonding due to the amide group, which may influence its physical properties such as melting point and boiling point. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen atom in the pyridine ring and the substituents attached to it. Overall, 5-(1-Methylethyl)-3-pyridinecarboxamide is a compound with unique structural features that may confer specific chemical and biological properties.

Formula: C₉H₁₂N₂O

InChI: InChI=1S/C9H12N2O/c1-6(2)7-3-8(9(10)12)5-11-4-7/h3-6H,1-2H3,(H2,10,12)

InChI key: InChIKey=ACSOTLQPAOXUKQ-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=C(C(N)=O)C=NC1

Synonyms:

• 5-(1-Methylethyl)-3-pyridinecarboxamide
• 3-Pyridinecarboxamide, 5-(1-methylethyl)-