
CAS 73594-97-5
:5-Amino-1-(3,5-dichlorophenyl)-1H-pyrazole-4-carbonitrile
Description:
5-Amino-1-(3,5-dichlorophenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an amino group and a cyano group at specific positions on the pyrazole ring contributes to its reactivity and potential biological activity. The 3,5-dichlorophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of agrochemicals or as a lead compound in medicinal chemistry due to its structural features that may exhibit anti-inflammatory or anti-cancer properties. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.
Formula:C10H6Cl2N4
InChI:InChI=1S/C10H6Cl2N4/c11-7-1-8(12)3-9(2-7)16-10(14)6(4-13)5-15-16/h1-3,5H,14H2
InChI key:InChIKey=SLNAEYPWVPWNBH-UHFFFAOYSA-N
SMILES:NC=1N(C2=CC(Cl)=CC(Cl)=C2)N=CC1C#N
Synonyms:- 1H-Pyrazole-4-carbonitrile, 5-amino-1-(3,5-dichlorophenyl)-
- 5-Amino-1-(3,5-dichlorophenyl)-1H-pyrazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.