CAS 73603-40-4
:(2R,3S,4S,5S,6R)-6-[(2S,3S,4R,5S,6S)-3-acetamido-2-[(2R,3S,4R,5S,6R)-6-[(2S,3S,4R,5S,6S)-3-acetamido-2-[(2R,3S,4R,5S,6R)-6-[(3S,4R,5S,6S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-2-carboxy-4,5-dihydroxy-tetrahydropyran-3-yl]oxy-
Description:
The chemical substance with the name provided is a complex glycosylated compound, characterized by multiple stereocenters and a series of hydroxyl and acetamido functional groups. It belongs to a class of molecules known as glycosides, which are typically formed from the reaction of a sugar with another functional group. The presence of multiple stereogenic centers indicates that this compound exhibits chirality, leading to distinct optical isomers. The hydroxymethyl and carboxy groups contribute to its hydrophilicity, enhancing solubility in polar solvents, while the acetamido groups may influence its biological activity and interactions. This compound is likely to be involved in biochemical processes, potentially serving as a substrate or inhibitor in enzymatic reactions. Its structural complexity suggests potential applications in pharmaceuticals or biochemistry, particularly in the development of therapeutics targeting specific biological pathways. The CAS number 73603-40-4 allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature.
Formula:C42H65N3O34
InChI:InChI=1/C42H65N3O34/c1-7(49)43-13-26(16(52)10(4-46)69-37(13)68)72-41-24(60)21(57)29(32(78-41)35(64)65)75-39-15(45-9(3)51)28(18(54)12(6-48)71-39)74-42-25(61)22(58)30(33(79-42)36(66)67)76-38-14(44-8(2)50)27(17(53)11(5-47)70-38)73-40-23(59)19(55)20(56)31(77-40)34(62)63/h10-33,37-42,46-48,52-61,68H,4-6H2,1-3H3,(H,43,49)(H,44,50)(H,45,51)(H,62,63)(H,64,65)(H,66,67)/t10-,11-,12-,13-,14-,15-,16+,17+,18+,19-,20-,21+,22+,23-,24-,25-,26+,27+,28+,29-,30-,31+,32+,33+,37?,38-,39-,40+,41+,42+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hyaluronate Hexasaccharide
CAS:Formula:C42H65N3O34Purity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:1,155.97Hyaluronic acid hexasaccharide
CAS:<p>Hyaluronic acid is a polysaccharide containing repeating disaccharide units of β-1,3-N-acetyl glucosamine and β-1, 4-glucuronicâ¯acid. A series of unsaturated oligosaccharides (oligouronic acids) are released from hyaluronic acid by the action of hyaluronidase on umbilical cord (Weissman, 1954). This hexasaccharide and other enzymatically produced polymer homologs have been of value in the study of hyaluronic acid metabolism in healthy and diseased tissues (Hascall, 2019).</p>Formula:C42H65N3O34Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:1,155.97 g/mol



