CAS 736075-46-0
:[2-(morpholin-4-ylmethyl)phenyl](phenyl)methanone
Description:
The chemical substance known as [2-(morpholin-4-ylmethyl)phenyl](phenyl)methanone, with the CAS number 736075-46-0, is characterized by its complex molecular structure, which includes a phenyl group, a ketone functional group, and a morpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. Morpholine, a cyclic amine, contributes to the compound's solubility in polar solvents and may influence its biological activity. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can affect its physical properties and interactions with biological targets. Additionally, the compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and material science. Safety and handling precautions should be observed due to the potential toxicity associated with some of its components.
Formula:C18H19NO2
InChI:InChI=1/C18H19NO2/c20-18(15-6-2-1-3-7-15)17-9-5-4-8-16(17)14-19-10-12-21-13-11-19/h1-9H,10-14H2
SMILES:c1ccc(cc1)C(=O)c1ccccc1CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.