CAS 736136-05-3

trans-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid

Description:

Trans-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure, which is substituted with a methoxybenzoyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in pharmaceuticals or as a chemical intermediate. The presence of the methoxy group enhances its lipophilicity, which can influence its solubility and reactivity. The carboxylic acid group provides acidic properties, allowing for potential interactions in biological systems or chemical reactions. Additionally, the trans configuration of the substituents around the cyclohexane ring can affect the compound's spatial orientation, impacting its physical and chemical behavior. Overall, this compound's unique structural features may lead to interesting biological activities or chemical reactivity, making it a subject of interest in various fields of research.

Formula: C₁₅H₁₈O₄

InChI: InChI=1/C15H18O4/c1-19-13-5-3-2-4-12(13)14(16)10-6-8-11(9-7-10)15(17)18/h2-5,10-11H,6-9H2,1H3,(H,17,18)/t10-,11-

InChI key: InChIKey=NMSIFNFDZHKEGS-XYPYZODXNA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)[C@H]2CC[C@H](C(O)=O)CC2

Synonyms:

• trans-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-(2-methoxybenzoyl)-, trans-