CAS 736136-09-7

trans-4-(4-Cyanobenzoyl)cyclohexanecarboxylic acid

Description:

Trans-4-(4-Cyanobenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a cyanobenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in organic solvents and moderate polarity due to the carboxylic acid functional group. The presence of the cyanobenzoyl group suggests that it may have significant electronic properties, potentially making it useful in applications such as materials science or pharmaceuticals. The trans configuration indicates that the substituents on the cyclohexane ring are positioned opposite each other, which can influence the compound's steric and electronic characteristics. Additionally, the compound may exhibit specific reactivity patterns typical of carboxylic acids, such as acid-base behavior and potential for esterification. Overall, trans-4-(4-Cyanobenzoyl)cyclohexanecarboxylic acid is a compound of interest for its unique structural features and potential applications in various chemical contexts.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1/C15H15NO3/c16-9-10-1-3-11(4-2-10)14(17)12-5-7-13(8-6-12)15(18)19/h1-4,12-13H,5-8H2,(H,18,19)/t12-,13-

InChI key: InChIKey=KSHPJPJXUBRPEF-JOCQHMNTNA-N

SMILES: C(=O)([C@H]1CC[C@H](C(O)=O)CC1)C2=CC=C(C#N)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4-(4-cyanobenzoyl)-, trans-
• trans-4-(4-Cyanobenzoyl)cyclohexanecarboxylic acid