CAS 736136-16-6

trans-4-(3-Chlorobenzoyl)cyclohexanecarboxylic acid

Description:

Trans-4-(3-Chlorobenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a 3-chlorobenzoyl moiety. This compound features a trans configuration, indicating that the substituents on the cyclohexane ring are positioned opposite each other, which can influence its physical and chemical properties, such as melting point and solubility. The presence of the carboxylic acid group contributes to its acidity and potential reactivity, while the 3-chlorobenzoyl group introduces a halogen, which can affect the compound's electronic properties and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific characteristics, such as solubility in various solvents, stability under different conditions, and reactivity with other chemical species, would depend on its molecular structure and the environment in which it is studied. Overall, trans-4-(3-Chlorobenzoyl)cyclohexanecarboxylic acid is a notable compound in organic chemistry with potential applications in various fields.

Formula: C₁₄H₁₅ClO₃

InChI: InChI=1/C14H15ClO3/c15-12-3-1-2-11(8-12)13(16)9-4-6-10(7-5-9)14(17)18/h1-3,8-10H,4-7H2,(H,17,18)/t9-,10-

InChI key: InChIKey=ICFBGWQDVCVUGG-MGCOHNPYNA-N

SMILES: C(=O)([C@H]1CC[C@H](C(O)=O)CC1)C2=CC(Cl)=CC=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4-(3-chlorobenzoyl)-, trans-
• trans-4-(3-Chlorobenzoyl)cyclohexane-1-carboxylic acid
• trans-4-(3-Chlorobenzoyl)cyclohexanecarboxylic acid