CAS 736136-19-9

trans-4-(4-Fluorobenzoyl)cyclohexanecarboxylic acid

Description:

Trans-4-(4-Fluorobenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a para-fluorobenzoyl moiety. This compound typically exhibits a solid-state at room temperature and is likely to be a white to off-white crystalline powder. The presence of the fluorine atom in the para position of the benzoyl group can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity compared to non-fluorinated analogs. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, while the cyclohexane ring provides a degree of rigidity to the molecular structure. This compound may be of interest in pharmaceutical research and development due to its potential biological activity, which could be influenced by the specific arrangement of its functional groups. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation.

Formula: C₁₄H₁₅FO₃

InChI: InChI=1/C14H15FO3/c15-12-7-5-10(6-8-12)13(16)9-1-3-11(4-2-9)14(17)18/h5-9,11H,1-4H2,(H,17,18)/t9-,11-

InChI key: InChIKey=UNBXJGIVEWFNMT-HOMQSWHANA-N

SMILES: C(=O)([C@H]1CC[C@H](C(O)=O)CC1)C2=CC=C(F)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4-(4-fluorobenzoyl)-, trans-
• trans-4-(4-Fluorobenzoyl)cyclohexanecarboxylic acid