CymitQuimica logo

CAS 736136-23-5

:

trans-4-(2,4-Dimethylbenzoyl)cyclohexanecarboxylic acid

Description:
Trans-4-(2,4-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with a carboxylic acid group and a 2,4-dimethylbenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in organic synthesis and materials science. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the aromatic component may provide stability and influence solubility in organic solvents. Additionally, the trans configuration of the substituents can affect the compound's steric properties and reactivity. Its molecular structure may also allow for interactions such as hydrogen bonding, which can be significant in determining its behavior in various chemical environments. Overall, trans-4-(2,4-Dimethylbenzoyl)cyclohexanecarboxylic acid is a compound of interest for further study in fields such as pharmaceuticals and polymer chemistry.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-3-8-14(11(2)9-10)15(17)12-4-6-13(7-5-12)16(18)19/h3,8-9,12-13H,4-7H2,1-2H3,(H,18,19)/t12-,13-
InChI key:InChIKey=PQEFQYNDOMBQDN-JOCQHMNTNA-N
SMILES:C(=O)(C1=C(C)C=C(C)C=C1)[C@H]2CC[C@H](C(O)=O)CC2
Synonyms:
  • Cyclohexanecarboxylic acid, 4-(2,4-dimethylbenzoyl)-, trans-
  • trans-4-(2,4-Dimethylbenzoyl)cyclohexanecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.