CAS 736136-24-6
:trans-4-(2,5-Dimethylbenzoyl)cyclohexanecarboxylic acid
Description:
Trans-4-(2,5-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane backbone substituted with a carboxylic acid group and a 2,5-dimethylbenzoyl moiety. This compound typically exhibits a solid state at room temperature and is likely to be a white to off-white crystalline powder. The presence of the carboxylic acid group suggests it can participate in hydrogen bonding, influencing its solubility in polar solvents. The bulky 2,5-dimethylbenzoyl group may impart steric hindrance, affecting its reactivity and interactions with other molecules. This compound may be of interest in various applications, including organic synthesis and materials science, particularly in the development of photoinitiators or as intermediates in the synthesis of more complex organic molecules. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-3-4-11(2)14(9-10)15(17)12-5-7-13(8-6-12)16(18)19/h3-4,9,12-13H,5-8H2,1-2H3,(H,18,19)/t12-,13-
InChI key:InChIKey=LCZMCICIEVFITO-JOCQHMNTNA-N
SMILES:C(=O)(C1=C(C)C=CC(C)=C1)[C@H]2CC[C@H](C(O)=O)CC2
Synonyms:- trans-4-(2,5-Dimethylbenzoyl)cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 4-(2,5-dimethylbenzoyl)-, trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.