CAS 736136-25-7

trans-4-(2,6-Dimethylbenzoyl)cyclohexanecarboxylic acid

Description:

Trans-4-(2,6-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a 2,6-dimethylbenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobicity due to the presence of the bulky aromatic group. The trans configuration indicates that the substituents on the cyclohexane ring are positioned opposite each other, which can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. The presence of the carboxylic acid group suggests acidic behavior, allowing for hydrogen bonding and solubility in polar solvents. This compound may be of interest in various applications, including pharmaceuticals and materials science, due to its unique structural features. Additionally, its specific interactions and stability can be influenced by environmental factors such as temperature and pH.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-10-4-3-5-11(2)14(10)15(17)12-6-8-13(9-7-12)16(18)19/h3-5,12-13H,6-9H2,1-2H3,(H,18,19)/t12-,13-

InChI key: InChIKey=RZFZOZPIIDIKJA-JOCQHMNTNA-N

SMILES: C(=O)(C1=C(C)C=CC=C1C)[C@H]2CC[C@H](C(O)=O)CC2

Synonyms:

• Cyclohexanecarboxylic acid, 4-(2,6-dimethylbenzoyl)-, trans-
• trans-4-(2,6-Dimethylbenzoyl)cyclohexanecarboxylic acid