CAS 736136-27-9

trans-4-(3,5-Dimethylbenzoyl)cyclohexanecarboxylic acid

Description:

Trans-4-(3,5-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a 3,5-dimethylbenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic interactions due to the bulky aromatic group. The presence of the carboxylic acid functional group suggests it can participate in hydrogen bonding, influencing its solubility and reactivity. The trans configuration indicates that the substituents on the cyclohexane ring are positioned opposite each other, which can affect the compound's three-dimensional conformation and steric interactions. This compound may be of interest in various applications, including pharmaceuticals and materials science, due to its unique structural features. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and it may exhibit specific biological activities or properties relevant to its functional groups.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-10-7-11(2)9-14(8-10)15(17)12-3-5-13(6-4-12)16(18)19/h7-9,12-13H,3-6H2,1-2H3,(H,18,19)/t12-,13-

InChI key: InChIKey=SBGJTNCBQFWRCF-JOCQHMNTNA-N

SMILES: C(=O)(C1=CC(C)=CC(C)=C1)[C@H]2CC[C@H](C(O)=O)CC2

Synonyms:

• trans-4-(3,5-Dimethylbenzoyl)cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-(3,5-dimethylbenzoyl)-, trans-