CAS 736136-31-5

(1R,2R)-2-[2-oxo-2-(p-tolyl)ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2R)-2-[2-oxo-2-(p-tolyl)ethyl]cyclohexane-1-carboxylic acid, with the CAS number 736136-31-5, is a chiral compound characterized by its cyclohexane backbone and a carboxylic acid functional group. This compound features a p-tolyl group, which is a para-substituted toluene moiety, contributing to its hydrophobic characteristics. The presence of the ketone group (2-oxo) indicates potential reactivity, particularly in nucleophilic addition reactions. The specific stereochemistry (1R,2R) suggests that the compound has distinct spatial arrangements that can influence its biological activity and interactions with other molecules. As a carboxylic acid, it is expected to exhibit acidic properties, potentially participating in acid-base reactions. The compound may also possess applications in pharmaceuticals or as an intermediate in organic synthesis due to its structural features. Overall, its unique combination of functional groups and stereochemistry makes it a compound of interest in various chemical and biological contexts.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-11-6-8-12(9-7-11)15(17)10-13-4-2-3-5-14(13)16(18)19/h6-9,13-14H,2-5,10H2,1H3,(H,18,19)/t13-,14-/m1/s1

SMILES: Cc1ccc(cc1)C(=O)C[C@H]1CCCC[C@H]1C(=O)O

cis-2-[2-(4-methylphenyl)-2-oxoethyl]cyclohexane-1-carboxylic acid

CAS: 736136-31-5

Formula: C₁₆H₂₀O₃

Purity: 95.0%

Molecular weight: 260.333

Ref: 10-F201289