CAS 736136-47-3

(1R,2R)-2-[2-(2-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2R)-2-[2-(2-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 736136-47-3, is characterized by its specific stereochemistry, indicated by the (1R,2R) configuration, which suggests that it has two chiral centers. This compound features a cyclohexane ring, which contributes to its cyclic structure, and a carboxylic acid functional group that imparts acidic properties. The presence of the 2-iodophenyl group introduces significant lipophilicity and potential for biological activity, while the 2-oxo-ethyl moiety suggests reactivity typical of carbonyl compounds. The overall structure indicates that this compound may exhibit interesting pharmacological properties, possibly acting as an intermediate in organic synthesis or as a lead compound in drug development. Its solubility, stability, and reactivity would depend on the specific conditions of use, including pH and solvent environment. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with the iodine substituent.

Formula: C₁₅H₁₇IO₃

InChI: InChI=1/C15H17IO3/c16-13-8-4-3-7-12(13)14(17)9-10-5-1-2-6-11(10)15(18)19/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,18,19)/t10-,11-/m1/s1

SMILES: C1CC[C@H]([C@H](C1)CC(=O)c1ccccc1I)C(=O)O