CAS 736136-48-4

(1R,2R)-2-[2-(3-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2R)-2-[2-(3-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 736136-48-4, is a chiral compound characterized by its cyclohexane backbone and functional groups that include a carboxylic acid and a ketone moiety. The presence of the 3-iodophenyl group introduces significant lipophilicity and potential for biological activity, making it of interest in medicinal chemistry. The stereochemistry indicated by the (1R,2R) configuration suggests specific spatial arrangements that can influence the compound's reactivity and interactions with biological targets. This compound may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity in various chemical reactions, including esterification and amidation. Its unique structure may also confer specific pharmacological properties, making it a candidate for further research in drug development or as a biochemical probe. Overall, the compound's characteristics are defined by its molecular structure, functional groups, and stereochemistry, which collectively influence its chemical behavior and potential applications.

Formula: C₁₅H₁₇IO₃

InChI: InChI=1/C15H17IO3/c16-12-6-3-5-11(8-12)14(17)9-10-4-1-2-7-13(10)15(18)19/h3,5-6,8,10,13H,1-2,4,7,9H2,(H,18,19)/t10-,13-/m1/s1

SMILES: C1CC[C@H]([C@H](C1)CC(=O)c1cccc(c1)I)C(=O)O