CAS 736136-49-5
:(1R,2R)-2-[2-(4-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2R)-2-[2-(4-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 736136-49-5, is a chiral compound characterized by its cyclohexane backbone and a carboxylic acid functional group. This compound features a 4-iodophenyl substituent, which contributes to its potential biological activity and lipophilicity. The presence of the ketone group in the ethyl side chain enhances its reactivity and may influence its interactions in biological systems. The specific stereochemistry indicated by the (1R,2R) configuration suggests that the compound may exhibit unique pharmacological properties due to its three-dimensional arrangement. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. Additionally, the iodine atom may impart specific characteristics such as increased molecular weight and altered electronic properties, which can affect the compound's solubility and binding affinity in biological targets. Overall, this compound represents a complex structure with potential implications in drug design and development.
Formula:C15H17IO3
InChI:InChI=1/C15H17IO3/c16-12-7-5-10(6-8-12)14(17)9-11-3-1-2-4-13(11)15(18)19/h5-8,11,13H,1-4,9H2,(H,18,19)/t11-,13-/m1/s1
SMILES:C1CC[C@H]([C@H](C1)CC(=O)c1ccc(cc1)I)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.