CymitQuimica logo

CAS 736136-50-8

:

(1R,2R)-2-[2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl]cyclohexane-1-carboxylic acid

Description:
The chemical substance known as (1R,2R)-2-[2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl]cyclohexane-1-carboxylic acid, with the CAS number 736136-50-8, is a complex organic compound characterized by its cyclohexane backbone and the presence of a carboxylic acid functional group. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The stereochemistry indicated by the (1R,2R) configuration suggests specific spatial arrangements of its substituents, which can affect its reactivity and interactions with biological targets. The presence of the ketone group (2-oxo) further adds to its reactivity profile, making it a potential candidate for various chemical reactions. This compound may be of interest in medicinal chemistry and drug development due to its unique structural features, which could contribute to its pharmacological properties. Overall, its characteristics make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C16H17F3O3
InChI:InChI=1/C16H17F3O3/c17-16(18,19)13-8-4-3-7-12(13)14(20)9-10-5-1-2-6-11(10)15(21)22/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,21,22)/t10-,11-/m1/s1
SMILES:C1CC[C@H]([C@H](C1)CC(=O)c1ccccc1C(F)(F)F)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.