CAS 736136-57-5

trans-4-[2-(2-Chlorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Trans-4-[2-(2-Chlorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its cyclohexane backbone, which is substituted with a carboxylic acid group and a 2-(2-chlorophenyl)-2-oxoethyl moiety. This compound features a trans configuration, indicating that the substituents on the cyclohexane ring are positioned opposite each other, which can influence its spatial arrangement and reactivity. The presence of the chlorophenyl group introduces a halogen, which can affect the compound's electronic properties and potential interactions in biological systems. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies and research, particularly in the context of its interactions with biological targets. Overall, the structural features of this compound suggest potential utility in various chemical and pharmaceutical applications.

Formula: C₁₅H₁₇ClO₃

InChI: InChI=1/C15H17ClO3/c16-13-4-2-1-3-12(13)14(17)9-10-5-7-11(8-6-10)15(18)19/h1-4,10-11H,5-9H2,(H,18,19)/t10-,11-

InChI key: InChIKey=HCWQYJDKWBKTPF-XYPYZODXNA-N

SMILES: C(C(=O)C1=C(Cl)C=CC=C1)[C@H]2CC[C@H](C(O)=O)CC2

Synonyms:

• trans-4-[2-(2-Chlorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-(2-chlorophenyl)-2-oxoethyl]-, trans-