CymitQuimica logo

CAS 736136-63-3

:

trans-4-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid

Description:
Trans-4-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a trifluoromethyl group attached to a phenyl moiety. This compound exhibits properties typical of carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the trifluoromethyl group enhances its lipophilicity and may impart specific biological activities, making it of interest in pharmaceutical research. The oxo group contributes to the compound's reactivity, potentially allowing for further chemical modifications. Additionally, the trans configuration of the cyclohexane derivative affects the spatial arrangement of substituents, which can influence the compound's overall stability and interaction with biological targets. Overall, this compound's unique combination of functional groups and structural characteristics makes it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C16H17F3O3
InChI:InChI=1/C16H17F3O3/c17-16(18,19)13-3-1-2-12(9-13)14(20)8-10-4-6-11(7-5-10)15(21)22/h1-3,9-11H,4-8H2,(H,21,22)/t10-,11-
InChI key:InChIKey=YFQPCWHDWXMIFZ-XYPYZODXNA-N
SMILES:C(C[C@H]1CC[C@H](C(O)=O)CC1)(=O)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • trans-4-[2-Oxo-2-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid
  • Cyclohexanecarboxylic acid, 4-[2-oxo-2-[3-(trifluoromethyl)phenyl]ethyl]-, trans-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.