CAS 736173-19-6

2-[amino(4-methylphenyl)methyl]naphthalen-1-ol hydrochloride

Description:

2-[Amino(4-methylphenyl)methyl]naphthalen-1-ol hydrochloride, with the CAS number 736173-19-6, is a chemical compound characterized by its complex structure, which includes a naphthalene core substituted with an amino group and a hydroxyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group suggests potential basic properties, while the hydroxyl group may impart some degree of acidity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and interactions with other molecules. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₈H₁₈ClNO

InChI: InChI=1/C18H17NO.ClH/c1-12-6-8-14(9-7-12)17(19)16-11-10-13-4-2-3-5-15(13)18(16)20;/h2-11,17,20H,19H2,1H3;1H

SMILES: Cc1ccc(cc1)C(c1ccc2ccccc2c1O)N.Cl

2-(Amino-p-tolyl-methyl)-naphthalen-1-ol hydrochloride

CAS: 736173-19-6

2-(Amino-p-tolyl-methyl)-naphthalen-1-ol hydrochloride

Purity: ≥95%

Molecular weight: 299.79g/mol

Ref: 54-OR307615