CAS 73618-59-4

4-nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)-1H-benzimidazole

Description:

4-Nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)-1H-benzimidazole is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with various fluorinated groups and a nitro group. The presence of the trifluoromethyl and tetrafluoroethyl groups contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. This compound is typically used in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its potential as a bioactive agent. Its molecular structure suggests it may exhibit interesting interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Additionally, the presence of multiple fluorine atoms can enhance stability and alter the compound's reactivity compared to non-fluorinated analogs. Safety and handling precautions are essential when working with this compound, as it may pose health risks typical of halogenated organic substances.

Formula: C₁₀H₄F₇N₃O₂

InChI: InChI=1/C10H4F7N3O2/c11-7(12)9(13,14)8-18-4-1-3(10(15,16)17)2-5(20(21)22)6(4)19-8/h1-2,7H,(H,18,19)

SMILES: c1c(cc(c2c1nc(C(C(F)F)(F)F)[nH]2)N(=O)=O)C(F)(F)F

Synonyms:

• 1H-Benzimidazole, 4-nitro-2-(1,1,2,2-tetrafluoroethyl)-6-(trifluoromethyl)-