CAS 7362-37-0
:trans-Sinapic acid
Description:
Trans-sinapic acid is a phenolic compound characterized by its aromatic structure, which includes a methoxy group and a vinyl group. It is a derivative of sinapic acid, distinguished by the trans configuration of its double bond. This compound is typically found in various plants and is known for its role in plant defense mechanisms and as a precursor in the biosynthesis of lignin. Trans-sinapic acid exhibits antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and antimicrobial effects. It is soluble in organic solvents and has limited solubility in water, making it more accessible in non-polar environments. The compound is often studied for its applications in food science, particularly in enhancing the stability and nutritional quality of food products. Additionally, trans-sinapic acid is of interest in the field of materials science for its potential use in the development of biopolymers and other sustainable materials. Overall, its unique chemical structure and beneficial properties make trans-sinapic acid a significant subject of research in various scientific disciplines.
Formula:C11H12O5
InChI:InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+
InChI key:InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-N
SMILES:O(C)C1=C(O)C(OC)=CC(/C=C/C(O)=O)=C1
Synonyms:- 2-Propenoic acid, 3-(4-hydroxy-3,5-dimethoxyphenyl)-, (2E)-
- Cinnamic acid, 4-hydroxy-3,5-dimethoxy-, (E)-
- 3,5-Dimethoxy-4-hydroxy-trans-cinnamic acid
- (2E)-3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-propenoic acid
- 2-Propenoic acid, 3-(4-hydroxy-3,5-dimethoxyphenyl)-, (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Trans-sinapic acid
CAS:Carboxylic acid with additional oxygen functionsFormula:C11H12O5Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:224.21(2E)-3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-propenoic Acid
CAS:Controlled Product<p>Stability Light Sensitive<br>Applications (2E)-3-(4-Hydroxy-3,5-dimethoxyphenyl)-2-propenoic Acid, is a reagent used as an analytical standard.<br></p>Formula:C11H12O5Color and Shape:NeatMolecular weight:224.21trans-Sinapic acid
CAS:Trans-Sinapic acid is an organic compound with the formula HOCHC(OH)CHCOH. It is a white solid that is soluble in water and ethanol. Trans-Sinapic acid is found in plants, such as the leaves of Vitexin, and has been shown to have various pharmacological activities including anti-inflammatory and anticholinesterase properties. Trans-Sinapic acid also has been shown to be a potent inhibitor of acetylcholinesterase (AChE) activity. AChE inhibitors are used clinically as treatments for Alzheimer's disease and other conditions involving memory loss and cognitive decline. Trans-Sinapic acid binds to AChE with high affinity and inhibits its ability to break down acetylcholine, thereby increasing its concentration at nerve junctions. This may lead to improvement in symptoms associated with Alzheimer's disease, such as memory loss and cognitive decline.Formula:C11H12O5Purity:Min. 95%Color and Shape:PowderMolecular weight:224.21 g/mol




